Products 1896428-24-2
CAS 1896428-24-2 is the registry number for 1-(2,6-Difluorophenyl)cyclopentan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,6-difluorophenyl)cyclopentan-1-amine;hydrochloride (CAS 1896428-24-2) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 1-(2,6-difluorophenyl)cyclopentan-1-amine;hydrochloride. InChIKey: FNPPQZNYBHPJIY-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)cyclopentan-1-amine;hydrochloride |
| InChIKey | FNPPQZNYBHPJIY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=CC=C2F)F)N.Cl |
Computed by PubChem (NCBI)