Products 1897933-73-1
CAS 1897933-73-1 is the registry number for ethyl 2-(4-bromo-2-methoxyphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-bromo-2-methoxyphenyl)-2-oxoacetate (CAS 1897933-73-1) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: ethyl 2-(4-bromo-2-methoxyphenyl)-2-oxoacetate. InChIKey: SDTJICGAMRQUCC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-methoxyphenyl)-2-oxoacetate |
| InChIKey | SDTJICGAMRQUCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C=C1)Br)OC |
Computed by PubChem (NCBI)