Products 19075-69-5
CAS 19075-69-5 is the registry number for Ethyl 2-formyl-5-methyl-1H-pyrrole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-formyl-5-methyl-1H-pyrrole-3-carboxylate (CAS 19075-69-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 2-formyl-5-methyl-1H-pyrrole-3-carboxylate. InChIKey: YDSRJOYRBFWCCI-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 2-formyl-5-methyl-1H-pyrrole-3-carboxylate |
| InChIKey | YDSRJOYRBFWCCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1)C)C=O |
Computed by PubChem (NCBI)