Products 1909295-04-0
CAS 1909295-04-0 is the registry number for rac-(4aR,5S)-8-Nitro-1H,2H,3H,4H,4aH,5H,6H-pyrido(1,2-a)quinoline-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylic acid (CAS 1909295-04-0) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: (4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylic acid. InChIKey: RIKMSJBWDDECKT-YPMHNXCESA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylic acid |
| InChIKey | RIKMSJBWDDECKT-YPMHNXCESA-N |
| SMILES | C1CCN2[C@@H](C1)[C@@H](CC3=C2C=CC(=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)