Products 1909336-09-9
CAS 1909336-09-9 is the registry number for 5-Cyclopropyl-7-oxa-5-azaspiro(3.4)octane-6,8-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-cyclopropyl-7-oxa-5-azaspiro[3.4]octane-6,8-dione (CAS 1909336-09-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-cyclopropyl-7-oxa-5-azaspiro[3.4]octane-6,8-dione. InChIKey: WMXUAMKQBUAKHS-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-cyclopropyl-7-oxa-5-azaspiro[3.4]octane-6,8-dione |
| InChIKey | WMXUAMKQBUAKHS-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(=O)OC(=O)N2C3CC3 |
Computed by PubChem (NCBI)