CAS 1909358-91-3 appears in our catalog under these names: (2E)-3-{1-[(tert-butoxy)carbonyl]-1h-pyrrol-2-yl}prop-2-enoic acid, 95%, (2E)-3-{1-((tert-butoxy)carbonyl)-1H-pyrrol-2-yl}prop-2-enoic acid, 95%, (2E)-3-{1-((tert-Butoxy)carbonyl)-1H-pyrrol-2-yl}prop-2-enoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 50mg.
(E)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]prop-2-enoic acid (CAS 1909358-91-3) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (E)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]prop-2-enoic acid. InChIKey: ZBTWJKYTBYYMDG-VOTSOKGWSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (E)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]prop-2-enoic acid |
| InChIKey | ZBTWJKYTBYYMDG-VOTSOKGWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC=C1/C=C/C(=O)O |
Computed by PubChem (NCBI)