CAS 191471-51-9 is the registry number for (1S,4S,5R,6S)-4-Amino-2-oxabicyclo(3.1.0)hexane-4,6-dicarboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
(1S,4S,5R,6S)-4-amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid (CAS 191471-51-9) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: (1S,4S,5R,6S)-4-amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid. InChIKey: YASVRZWVUGJELU-ADXDAQDCSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (1S,4S,5R,6S)-4-amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid |
| InChIKey | YASVRZWVUGJELU-ADXDAQDCSA-N |
| SMILES | C1[C@@]([C@H]2[C@@H]([C@H]2O1)C(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)