Products 2923356-57-2
CAS 2923356-57-2 is the registry number for (2S,3S)-3-(Methoxycarbonyl)-5-oxopyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid (CAS 2923356-57-2) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: (2S,3S)-3-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid. InChIKey: FTTNVNAMVLAGTB-UCORVYFPSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (2S,3S)-3-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | FTTNVNAMVLAGTB-UCORVYFPSA-N |
| SMILES | COC(=O)[C@H]1CC(=O)N[C@@H]1C(=O)O |
Computed by PubChem (NCBI)