Products 1934442-79-1
CAS 1934442-79-1 is the registry number for 2-(5-Oxopyrrolidin-2-yl)propanedioic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-oxopyrrolidin-2-yl)propanedioic acid (CAS 1934442-79-1) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: 2-(5-oxopyrrolidin-2-yl)propanedioic acid. InChIKey: DRPSXXZDOVAZMU-UHFFFAOYSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 2-(5-oxopyrrolidin-2-yl)propanedioic acid |
| InChIKey | DRPSXXZDOVAZMU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)