Products 682774-01-2
CAS 682774-01-2 is the registry number for (S)-1-(Carboxymethyl)-5-oxopyrrolidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(carboxymethyl)-5-oxopyrrolidine-2-carboxylic acid (CAS 682774-01-2) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: (2S)-1-(carboxymethyl)-5-oxopyrrolidine-2-carboxylic acid. InChIKey: ZHWLDBWSTPLNPG-BYPYZUCNSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (2S)-1-(carboxymethyl)-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | ZHWLDBWSTPLNPG-BYPYZUCNSA-N |
| SMILES | C1CC(=O)N([C@@H]1C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)