CAS 541-89-9 is the registry number for Fumaryl-DL-alanine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-4-(1-carboxyethylamino)-4-oxobut-2-enoic acid (CAS 541-89-9) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: (E)-4-(1-carboxyethylamino)-4-oxobut-2-enoic acid. InChIKey: GNLCKFJPWPKISM-NSCUHMNNSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (E)-4-(1-carboxyethylamino)-4-oxobut-2-enoic acid |
| InChIKey | GNLCKFJPWPKISM-NSCUHMNNSA-N |
| SMILES | CC(C(=O)O)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)