Products 904217-40-9
CAS 904217-40-9 is the registry number for (2E)-3-[(2-Carboxyethyl)carbamoyl]prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-4-(2-carboxyethylamino)-4-oxobut-2-enoic acid (CAS 904217-40-9) is a chemical compound with the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. IUPAC name: (E)-4-(2-carboxyethylamino)-4-oxobut-2-enoic acid. InChIKey: JYXLDXBKFBWKOV-OWOJBTEDSA-N.
| Molecular formula | C7H9NO5 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (E)-4-(2-carboxyethylamino)-4-oxobut-2-enoic acid |
| InChIKey | JYXLDXBKFBWKOV-OWOJBTEDSA-N |
| SMILES | C(CNC(=O)/C=C/C(=O)O)C(=O)O |
Computed by PubChem (NCBI)