Products 1932106-37-0
CAS 1932106-37-0 is the registry number for (1R,3S)-3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarboxamide. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
Cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide (CAS 1932106-37-0) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide. InChIKey: LGLPSKCJXYYLMZ-XINAWCOVSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| InChIKey | LGLPSKCJXYYLMZ-XINAWCOVSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)N)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)