Products 494846-52-5
CAS 494846-52-5 is the registry number for (1S,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxamide, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide (CAS 494846-52-5) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide. InChIKey: LGLPSKCJXYYLMZ-INEUFUBQSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| InChIKey | LGLPSKCJXYYLMZ-INEUFUBQSA-N |
| SMILES | CC1([C@@H]([C@@H]1C(=O)N)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)