CAS 1936009-13-0 appears in our catalog under these names: Methyl 2,3-dihydro-1H-pyrrolo(2,3-b)pyridine-5-carboxylate, 97%, Methyl 1H,2H,3H-pyrrolo(2,3-b)pyridine-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g, 50mg.
Methyl 2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS 1936009-13-0) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: methyl 2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate. InChIKey: YLGUVPMSTABGHT-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| InChIKey | YLGUVPMSTABGHT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(NCC2)N=C1 |
Computed by PubChem (NCBI)