CAS 1936016-08-8 is the registry number for 7-Bromo-3-hydroxyisoindolin-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
7-bromo-3-hydroxy-2,3-dihydroisoindol-1-one (CAS 1936016-08-8) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 7-bromo-3-hydroxy-2,3-dihydroisoindol-1-one. InChIKey: JCKKLQQRXDXCHV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 7-bromo-3-hydroxy-2,3-dihydroisoindol-1-one |
| InChIKey | JCKKLQQRXDXCHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)NC2O |
Computed by PubChem (NCBI)