Products 1936146-98-3
CAS 1936146-98-3 appears in our catalog under these names: 8-Bromo-1,3-dichloroisoquinoline, 98%, 98%, 8-BROMO-1,3-DICHLOROISOQUINOLINE, 98%, 8-Bromo-1,3-dichloroisoquinoline. Offered by: Chemat, Fluorochem, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
8-bromo-1,3-dichloroisoquinoline (CAS 1936146-98-3) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 8-bromo-1,3-dichloroisoquinoline. InChIKey: HEJRRQJXKBBQLU-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 8-bromo-1,3-dichloroisoquinoline |
| InChIKey | HEJRRQJXKBBQLU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC(=C2C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)