CAS 19490-60-9 is the registry number for 2-Amino-3',4'-dihydroxypropiophenone. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
2-amino-1-(3,4-dihydroxyphenyl)propan-1-one (CAS 19490-60-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-1-(3,4-dihydroxyphenyl)propan-1-one. InChIKey: VTUFBPJUFSJZCT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-1-(3,4-dihydroxyphenyl)propan-1-one |
| InChIKey | VTUFBPJUFSJZCT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)O)O)N |
Computed by PubChem (NCBI)