CAS 19506-87-7 appears in our catalog under these names: Phthaloyl–DL–alanine, 2-(1,3-Dioxoisoindolin-2-yl)propanoic acid 98%, 2-(1,3-Dioxoisoindolin-2-yl)propanoic acid, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g.
2-(1,3-dioxoisoindol-2-yl)propanoic acid (CAS 19506-87-7) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: OZWUITKBAWTEAQ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)propanoic acid |
| InChIKey | OZWUITKBAWTEAQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)