CAS 4192-28-3 appears in our catalog under these names: N-phthalyl-L-alanine, Phthaloyl-L-alanine, Pht-Ala-OH, >98.0%(HPLC)(T), (S)-2-(1,3-Dioxoisoindolin-2-yl)propanoic acid 97%, 2H-Isoindole-2-acetic acid, 1,3-dihydro-α-methyl-1,3-dioxo-, (αS)-, 98%, 98%. Offered by: Chemat Brand, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: on request, 100g, 25g, 250g, 500g, 1000g, 10g, 5g.
(2S)-2-(1,3-dioxoisoindol-2-yl)propanoic acid (CAS 4192-28-3) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: OZWUITKBAWTEAQ-LURJTMIESA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)propanoic acid |
| InChIKey | OZWUITKBAWTEAQ-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)