CAS 29588-83-8 appears in our catalog under these names: (R)-2-(1,3-Dioxoisoindolin-2-yl)propanoic acid, 95%, (R)-2-(1,3-dioxoisoindolin-2-yl)propanoic acid 95%, (R)-2-(1,3-dioxoisoindolin-2-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g.
(2R)-2-(1,3-dioxoisoindol-2-yl)propanoic acid (CAS 29588-83-8) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: (2R)-2-(1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: OZWUITKBAWTEAQ-ZCFIWIBFSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2R)-2-(1,3-dioxoisoindol-2-yl)propanoic acid |
| InChIKey | OZWUITKBAWTEAQ-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)