CAS 19506-89-9 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-4-methylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid (CAS 19506-89-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid. InChIKey: RMOSZIHTPMEZAP-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid |
| InChIKey | RMOSZIHTPMEZAP-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)