CAS 29588-87-2 is the registry number for (2R)–2–(1,3–Dioxoisoindol–2–yl)–4–methylpentanoic acid. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid (CAS 29588-87-2) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid. InChIKey: RMOSZIHTPMEZAP-LLVKDONJSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid |
| InChIKey | RMOSZIHTPMEZAP-LLVKDONJSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)