CAS 19522-96-4 is the registry number for 7-Bromo-benzo(1,3)dioxole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g.
7-bromo-1,3-benzodioxole-5-carbaldehyde (CAS 19522-96-4) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 7-bromo-1,3-benzodioxole-5-carbaldehyde. InChIKey: LFWAGNRBILVLBC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 7-bromo-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | LFWAGNRBILVLBC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C=O)Br |
Computed by PubChem (NCBI)