CAS 1955498-07-3 appears in our catalog under these names: 7-Hydrazinyl-1H-1,3-benzodiazole dihydrochloride, 95%, 7-Hydrazinyl-1H-1,3-benzodiazole dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1H-benzimidazol-4-ylhydrazine;dihydrochloride (CAS 1955498-07-3) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: 1H-benzimidazol-4-ylhydrazine;dihydrochloride. InChIKey: KTVAMODISHQFNJ-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 1H-benzimidazol-4-ylhydrazine;dihydrochloride |
| InChIKey | KTVAMODISHQFNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NN)N=CN2.Cl.Cl |
Computed by PubChem (NCBI)