Products 1955540-35-8

CAS 1955540-35-8 is the registry number for Methyl 3-hydrazinyl-2-methylbenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 3-hydrazinyl-2-methylbenzoate;hydrochloride (CAS 1955540-35-8) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: methyl 3-hydrazinyl-2-methylbenzoate;hydrochloride. InChIKey: ZEXTZUHFKXXRPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O2
Molecular weight216.66 g/mol
IUPAC namemethyl 3-hydrazinyl-2-methylbenzoate;hydrochloride
InChIKeyZEXTZUHFKXXRPZ-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1NN)C(=O)OC.Cl

Computed by PubChem (NCBI)