CAS 1956434-77-7 is the registry number for H-D-Mephe-oh hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride (CAS 1956434-77-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2R)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride. InChIKey: DFQSBSADGQZNFW-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2R)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride |
| InChIKey | DFQSBSADGQZNFW-SBSPUUFOSA-N |
| SMILES | CN[C@H](CC1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)