CAS 66866-67-9 appears in our catalog under these names: N-Alpha-methyl-L-phenylalanine hydrochloride, 98%, N-α-methyl-L-Phenylalanine hydrochloride. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 25g, 100g, 1g, 5g, on request.
(2S)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride (CAS 66866-67-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2S)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride. InChIKey: DFQSBSADGQZNFW-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-phenylpropanoic acid;hydrochloride |
| InChIKey | DFQSBSADGQZNFW-FVGYRXGTSA-N |
| SMILES | CN[C@@H](CC1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)