Products 349554-00-3
CAS 349554-00-3 appears in our catalog under these names: Enalaprilat-d5 (Enalapril EP Impurity C-d5), Enalaprilat-d5 (phenyl-d5), Enalaprilat-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Enalaprilat D5, Enalaprilat-d5, 99.91%. Offered by: Chemat Brand, TRC, CDN, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g, 1mg, 25mg, 50mg.
(2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 349554-00-3) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: LZFZMUMEGBBDTC-HJJZLVALSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | LZFZMUMEGBBDTC-HJJZLVALSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC[C@@H](C(=O)O)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)