Products 196953-06-7
CAS 196953-06-7 is the registry number for 1-(3-Bromophenyl)-2,3-butadien-1-one, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-bromophenyl)buta-2,3-dien-1-one (CAS 196953-06-7) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 1-(3-bromophenyl)buta-2,3-dien-1-one. InChIKey: ZVYVZARHEUITKN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 1-(3-bromophenyl)buta-2,3-dien-1-one |
| InChIKey | ZVYVZARHEUITKN-UHFFFAOYSA-N |
| SMILES | C=C=CC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)