CAS 197775-45-4 appears in our catalog under these names: 5-(Pyrid-4-yl)-3-pyrazolecarboxylic acid, 5-Pyridin-4-yl-1H-pyrazole-3-carboxylic acid, 96%, 3-(4-Pyridinyl)-1h-pyrazole-5-carboxylic acid hydrochloride, 95%, 5–(pyridin–4–yl)–1H–pyrazole–3–carboxylic acid, 5-Pyridin-4-yl-1H-pyrazole-3-carboxylic acid. Offered by: Fluorochem, Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg, 500mg, 1000mg.
3-pyridin-4-yl-1H-pyrazole-5-carboxylic acid (CAS 197775-45-4) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-pyridin-4-yl-1H-pyrazole-5-carboxylic acid. InChIKey: PHKNKTBPYNCTGD-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-pyridin-4-yl-1H-pyrazole-5-carboxylic acid |
| InChIKey | PHKNKTBPYNCTGD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)