CAS 19808-38-9 is the registry number for 6,8-Dichloroquinazolin-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6,8-dichloroquinazolin-4-amine (CAS 19808-38-9) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 6,8-dichloroquinazolin-4-amine. InChIKey: QZVUSDUFBVJYHK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 6,8-dichloroquinazolin-4-amine |
| InChIKey | QZVUSDUFBVJYHK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC=N2)N)Cl)Cl |
Computed by PubChem (NCBI)