Products 19920-08-2
CAS 19920-08-2 is the registry number for (2,3-Dichlorophenyl)(phenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,3-dichlorophenyl)-phenylmethanone (CAS 19920-08-2) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,3-dichlorophenyl)-phenylmethanone. InChIKey: RLUFBDIRFJGKLY-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,3-dichlorophenyl)-phenylmethanone |
| InChIKey | RLUFBDIRFJGKLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)