CAS 19933-22-3 appears in our catalog under these names: 1-Phenylpyrazolidine-3,5-dione, 95%, 1–Phenyl–pyrazolidine–3,5–dione, 1-Phenyl-pyrazolidine-3,5-dione, 1-Phenyl-pyrazolidine-3,5-dione 97%, 1-Phenyl-pyrazolidine-3,5-dione, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g, 10g.
1-phenylpyrazolidine-3,5-dione (CAS 19933-22-3) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-phenylpyrazolidine-3,5-dione. InChIKey: JHRGJMLMFWJXOG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-phenylpyrazolidine-3,5-dione |
| InChIKey | JHRGJMLMFWJXOG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NN(C1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)