Products 1995072-64-4
CAS 1995072-64-4 is the registry number for 8-Chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine (CAS 1995072-64-4) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine. InChIKey: PVNFYLDXJCSIIJ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| InChIKey | PVNFYLDXJCSIIJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C3CCCC3=C2N)Cl |
Computed by PubChem (NCBI)