Products 199536-01-1
CAS 199536-01-1 appears in our catalog under these names: 3-Amino-5-cyano-benzoic acid methyl ester, Methyl 3-Amino-5-cyanobenzoate, 95%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100g.
Methyl 3-amino-5-cyanobenzoate (CAS 199536-01-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 3-amino-5-cyanobenzoate. InChIKey: PEYGSXLYSVLVEL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 3-amino-5-cyanobenzoate |
| InChIKey | PEYGSXLYSVLVEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#N)N |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3-amino-5-cyanobenzoate, 3-amino-5-cyano-benzoic acid methyl ester, Benzoic acid, 3-amino-5-cyano-, methyl ester, 3-amino-5-cyano-benzoic acid methyl ester >98%, methyl 3-amino-5-cyano-benzoate, 3-Amino-5-cyano-benzoic acid me, PEYGSXLYSVLVEL-UHFFFAOYSA-N, 3-Amino-5-cyano-benzoic acid methyl ester 95+%