Products 199851-52-0
CAS 199851-52-0 is the registry number for Isocudraniaxanthone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,5,6-trihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one (CAS 199851-52-0) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 1,5,6-trihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one. InChIKey: PELOBHLTYBBGDO-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 1,5,6-trihydroxy-3-methoxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one |
| InChIKey | PELOBHLTYBBGDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C1=C(C=C(C2=C1OC3=C(C2=O)C=CC(=C3O)O)O)OC |
Computed by PubChem (NCBI)