CAS 20099-90-5 appears in our catalog under these names: 4-(2-Bromoacetyl)benzoic Acid, 4-(2-Bromoacetyl)benzoic acid 95%, 4-(2-Bromoacetyl)benzoic acid, 95%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 750mg, 250mg, 1g, 5g, 10g, 25g.
4-(2-bromoacetyl)benzoic acid (CAS 20099-90-5) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 4-(2-bromoacetyl)benzoic acid. InChIKey: ZMHLKKVZTJBBHK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 4-(2-bromoacetyl)benzoic acid |
| InChIKey | ZMHLKKVZTJBBHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)