Products 2016044-62-3
CAS 2016044-62-3 is the registry number for Methyl (R)-2-(Fmoc-amino)-3-hydroxy-2-methylpropanoate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-2-methylpropanoate (CAS 2016044-62-3) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-2-methylpropanoate. InChIKey: NCEBNRDDSXHJAJ-HXUWFJFHSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-2-methylpropanoate |
| InChIKey | NCEBNRDDSXHJAJ-HXUWFJFHSA-N |
| SMILES | C[C@@](CO)(C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)