CAS 201740-75-2 appears in our catalog under these names: L–Arginine–1,2–13C2 hydrochloride, L-Arginine-1,2-13C2 (hydrochloride), 98.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg, 50 mg, 25 mg, 10 mg.
(2S)-2-amino-5-(diaminomethylideneamino)(1,2-13C2)pentanoic acid;hydrochloride (CAS 201740-75-2) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 212.65 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)(1,2-13C2)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-GSAMYSAMSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)(1,2-13C2)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-GSAMYSAMSA-N |
| SMILES | C(C[13C@@H]([13C](=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)