CAS 32042-43-6 appears in our catalog under these names: DL-Arginine, DL-Arginine hydrochloride, Dl-Arginine Hydrochloride, >95% (HPLC), DL–Arginine Hydrochloride, DL-Arginine hydrochloride . Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 100mg, 1g, 500mg, 5g, 100g, 25g, 0,25kg.
2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (CAS 32042-43-6) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 210.66 g/mol. IUPAC name: 2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-UHFFFAOYSA-N |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)