Products 1245727-44-9
CAS 1245727-44-9 is the registry number for 1-(2-Aminoethoxy)-2-(2-azidoethoxy)ethane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[2-(2-azidoethoxy)ethoxy]ethanamine;hydrochloride (CAS 1245727-44-9) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 210.66 g/mol. IUPAC name: 2-[2-(2-azidoethoxy)ethoxy]ethanamine;hydrochloride. InChIKey: NZGULSXSYLKLEJ-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-[2-(2-azidoethoxy)ethoxy]ethanamine;hydrochloride |
| InChIKey | NZGULSXSYLKLEJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCN=[N+]=[N-])N.Cl |
Computed by PubChem (NCBI)