Products 204633-95-4
CAS 204633-95-4 appears in our catalog under these names: L-Arginine-15N4 Hydrochloride, >95% (HPLC), L-Arginine-15N4 hydrochloride, 98% 10atom%15N, L–Arginine–15N4 hydrochloride, L-Arginine-15N4 (hydrochloride), ≥10 atom%,≥98.5%, ≥10 atom%,≥98.5%, L-Arginine-15N4 (hydrochloride), 99.94%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 100mg, 5mg, 50mg, 25mg, 500mg, 100 mg.
(2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride (CAS 204633-95-4) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 214.63 g/mol. IUPAC name: (2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-JYJSWXFRSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-JYJSWXFRSA-N |
| SMILES | C(C[C@@H](C(=O)O)[15NH2])C[15N]=C([15NH2])[15NH2].Cl |
Computed by PubChem (NCBI)