CAS 627-75-8 appears in our catalog under these names: H–D–Arg–OH·HCl, H-D-Arg-OH*HCl, D-Arginine monohydrochloride, 98% , D-Arginine hydrochloride, D-Arginine monohydrochloride. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 50g.
(2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (CAS 627-75-8) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 210.66 g/mol. IUPAC name: (2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-PGMHMLKASA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | (2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-PGMHMLKASA-N |
| SMILES | C(C[C@H](C(=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)