Products 202468-25-5
CAS 202468-25-5 appears in our catalog under these names: L–Arginine–13C6,15N4 hydrochloride, L-Arginine-13C6,15N4 Hydrochloride, >95% (HPLC), L-Arginine-13C6，15N4 hydrochloride, L-Arginine-13C6,15N4 (hydrochloride), 99.85%, L-Arginine 13C6 15N4 monohydrochloride, min. 98 % 13C 15N, 100 mg, plastic. Offered by: GLPBio, TRC, Chemat, MedChemExpress, Roth. Available pack sizes: 5mg, 10mg, 25mg, 500mg, 5 mg, 25 mg, 10 mg, 50 mg.
(2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)(113C)methylideneamino](1,2,3,4,5-13C5)pentanoic acid;hydrochloride (CAS 202468-25-5) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 220.59 g/mol. IUPAC name: (2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)(113C)methylideneamino](1,2,3,4,5-13C5)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-YAUSPDTOSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 220.59 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-5-[bis(15N)(azanyl)(113C)methylideneamino](1,2,3,4,5-13C5)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-YAUSPDTOSA-N |
| SMILES | [13CH2]([13CH2][13C@@H]([13C](=O)O)[15NH2])[13CH2][15N]=[13C]([15NH2])[15NH2].Cl |
Computed by PubChem (NCBI)