Products 204244-77-9
CAS 204244-77-9 appears in our catalog under these names: L-Arginine-2,3,3,4,4,5,5-d7 HCl, L-Arginine-2,3,3,4,4,5,5-d7 HCl, >95% (HPLC), L-Arginine-2,3,3,4,4,5,5-d7 HCl, 98 atom % D, min 97% Chemical Purity, L–Arginine–d7 (hydrochloride), L-Arginine-d7 hydrochloride. Offered by: Chemat Brand, TRC, CDN, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2mg, 0,1g, 0,05g, 5mg, 50mg.
(2S)-2-amino-2,3,3,4,4,5,5-heptadeuterio-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (CAS 204244-77-9) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 217.70 g/mol. IUPAC name: (2S)-2-amino-2,3,3,4,4,5,5-heptadeuterio-5-(diaminomethylideneamino)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-AHQNDZJWSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 217.70 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3,4,4,5,5-heptadeuterio-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-AHQNDZJWSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C([2H])([2H])N=C(N)N)N.Cl |
Computed by PubChem (NCBI)