Products 202057-74-7
CAS 202057-74-7 appears in our catalog under these names: Leflunomide Impurity 1, (2Z)-2-Cyano-N-(4-cyanophenyl)-3-hydroxy-2-Butenamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(Z)-2-cyano-N-(4-cyanophenyl)-3-hydroxybut-2-enamide (CAS 202057-74-7) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: (Z)-2-cyano-N-(4-cyanophenyl)-3-hydroxybut-2-enamide. InChIKey: CJLVNIUFPOODAD-FLIBITNWSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (Z)-2-cyano-N-(4-cyanophenyl)-3-hydroxybut-2-enamide |
| InChIKey | CJLVNIUFPOODAD-FLIBITNWSA-N |
| SMILES | C/C(=C(\C#N)/C(=O)NC1=CC=C(C=C1)C#N)/O |
Computed by PubChem (NCBI)