CAS 2031242-65-4 is the registry number for rac-(2R,3R)-3-((1H-Imidazol-1-yl)methyl)oxolane-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(2R,3R)-3-(imidazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride (CAS 2031242-65-4) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: (2R,3R)-3-(imidazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride. InChIKey: XKXQJNDIVXUHME-SCLLHFNJSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (2R,3R)-3-(imidazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride |
| InChIKey | XKXQJNDIVXUHME-SCLLHFNJSA-N |
| SMILES | C1CO[C@H]([C@H]1CN2C=CN=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)