CAS 203578-30-7 is the registry number for Tetramethyl Bisphenol A-d6. Offered by: TRC. Available pack sizes: 1mg, 25mg.
4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol (CAS 203578-30-7) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 290.4 g/mol. IUPAC name: 4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol. InChIKey: ODJUOZPKKHIEOZ-SCPKHUGHSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol |
| InChIKey | ODJUOZPKKHIEOZ-SCPKHUGHSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=C(C(=C1)C)O)C)(C2=CC(=C(C(=C2)C)O)C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)