Products 2044901-34-8
CAS 2044901-34-8 appears in our catalog under these names: 4-(2,2-Difluorocyclopropoxy)benzoic acid, 95%, 4-(2,2-Difluorocyclopropoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2,2-difluorocyclopropyl)oxybenzoic acid (CAS 2044901-34-8) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 4-(2,2-difluorocyclopropyl)oxybenzoic acid. InChIKey: SKMMNFWHMXBWRZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 4-(2,2-difluorocyclopropyl)oxybenzoic acid |
| InChIKey | SKMMNFWHMXBWRZ-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)